Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A120 | Purity: >98% |
 | |
| Chemical structure of D-6413 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 74588-78-6 |
|---|---|
| Purity | >98% |
| Formula | C16H13NO2 |
| Mol Weight | 251.2799 |
| CoA | CoA of D-6413 |
| Smiles: | COC1=CC2=C(NC(=C2)C(=O)C2=CC=CC=C2)C=C1 |
|---|
KEYWORDS: buy D-6413 | D-6413 supplier | purchase | cost | manufacturer | order | distributor | buy 74588-78-6 | 74588-78-6 supplier