Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2222 | Purity: >98% |
 | |
| Chemical structure of CZC-54252 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1191911-27-9 |
|---|---|
| Purity | >98% |
| Formula | C22H25ClN6O4S |
| Mol Weight | 504.99 |
| CoA | CoA of CZC-54252 |
| Smiles: | COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2NS(C)(=O)=O)=N1)N1CCOCC1 |
|---|
KEYWORDS: buy CZC-54252 | CZC-54252 supplier | purchase | cost | manufacturer | order | distributor | buy 1191911-27-9 | 1191911-27-9 supplier