Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4029 | Purity: >98% |
 | |
| Chemical structure of Cytosporone B |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 321661-62-5 |
|---|---|
| Purity | >98% |
| Formula | C18H26O5 |
| Mol Weight | 322.396 |
| CoA | CoA of Cytosporone B |
| Smiles: | O=C(OCC)CC1=CC(O)=CC(O)=C1C(CCCCCCC)=O |
|---|
KEYWORDS: buy Cytosporone B | Cytosporone B supplier | purchase | cost | manufacturer | order | distributor | buy 321661-62-5 | 321661-62-5 supplier