Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9869 | Purity: >98% |
 | |
| Chemical structure of Cypate-NHS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Cypate bisNHS |
|---|---|
| Synonyms 2 | lipo Cy7.5(diPrAcid) di SE |
| Purity | >98% |
| Formula | C49H47ClN4O8 |
| Mol Weight | 855.372 |
| CoA | CoA of Cypate-NHS |
| Smiles: | [Cl-].CC1(C)\C(=C/C=C/C=C/C=C/C2=[N+](CCC(=O)ON3C(=O)CCC3=O)C3=C(C4=C(C=CC=C4)C=C3)C2(C)C)N(CCC(=O)ON2C(=O)CCC2=O)C2=C1C1=C(C=CC=C1)C=C2 |
|---|
KEYWORDS: buy Cypate-NHS | Cypate-NHS supplier | purchase | cost | manufacturer | order | distributor | buy | supplier