Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A903 | Purity: >98% |
 | |
| Chemical structure of CYM5442 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1094042-01-9 |
|---|---|
| Purity | >98% |
| Formula | C23H27N3O4 |
| Mol Weight | 409.4782 |
| CoA | CoA of CYM5442 |
| Smiles: | CCOC1=CC=C(C=C1OCC)C1=NC(=NO1)C1=CC=CC2=C1CCC2NCCO |
|---|
KEYWORDS: buy CYM5442 | CYM5442 supplier | purchase | cost | manufacturer | order | distributor | buy 1094042-01-9 | 1094042-01-9 supplier