Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4979 | Purity: >98% |
 | |
| Chemical structure of CYM-5520 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1449747-00-5 |
|---|---|
| Purity | >98% |
| Formula | C21H19N3O2 |
| Mol Weight | 345.3945 |
| CoA | CoA of CYM-5520 |
| Smiles: | CC1=CC(=C(N1CC2=CC=CC=C2)C)C(=O)CN3C=C(C=CC3=O)C#N |
|---|
KEYWORDS: buy CYM-5520 | CYM-5520 supplier | purchase | cost | manufacturer | order | distributor | buy 1449747-00-5 | 1449747-00-5 supplier