Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3331 | Purity: >98% |
 | |
| Chemical structure of Cyclo(-Phe-Pro) |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3705-26-8 |
|---|---|
| Purity | >98% |
| Formula | C14H16N2O2 |
| Mol Weight | 244.289 |
| CoA | CoA of Cyclo(-Phe-Pro) |
| Smiles: | C1C[C@H]2C(=O)N[C@H](C(=O)N2C1)CC3=CC=CC=C3 |
|---|
KEYWORDS: buy Cyclo(-Phe-Pro) | Cyclo(-Phe-Pro) supplier | purchase | cost | manufacturer | order | distributor | buy 3705-26-8 | 3705-26-8 supplier