Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9100 | Purity: >98% |
 | |
| Chemical structure of CYB-2108 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2762567-99-5 |
|---|---|
| Purity | >98% |
| Formula | C11H14F3NO2S |
| Mol Weight | 281.295 |
| CoA | CoA of CYB-2108 |
| Smiles: | FC(F)(F)SC1=CC(OC)=C(C=C1OC)CCN |
|---|
KEYWORDS: buy CYB-2108 | CYB-2108 supplier | purchase | cost | manufacturer | order | distributor | buy 2762567-99-5 | 2762567-99-5 supplier