Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15798 | Purity: >98% |
 | |
| Chemical structure of CXCR7 HCl salt |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1226686-30-1 |
|---|---|
| Purity | >98% |
| Formula | C25H26N4OS |
| Mol Weight | 430.565 |
| CoA | CoA of CXCR7 HCl salt |
| Smiles: | N=1C=CC=C2C=CC(OC)=C(C12)N3CCN(CC=4N=C(SC4)C=5C=CC=CC5)CCC3 |
|---|
KEYWORDS: buy CXCR7 HCl salt | CXCR7 HCl salt supplier | purchase | cost | manufacturer | order | distributor | buy 1226686-30-1 | 1226686-30-1 supplier