Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2681 | Purity: >98% |
 | |
| Chemical structure of CV-6504 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 117574-40-0 |
|---|---|
| Purity | >98% |
| Formula | C15H15NO2 |
| Mol Weight | 241.2851 |
| CoA | CoA of CV-6504 |
| Smiles: | CC1=C(C)C(=O)C(CC2=CN=CC=C2)=C(C)C1=O |
|---|
KEYWORDS: buy CV-6504 | CV-6504 supplier | purchase | cost | manufacturer | order | distributor | buy 117574-40-0 | 117574-40-0 supplier