Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10621 | Purity: >98% |
 | |
| Chemical structure of Curzerene |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 17910-09-7 |
|---|---|
| Purity | >98% |
| Formula | C15H20O |
| Mol Weight | 216.3187 |
| CoA | CoA of Curzerene |
| Smiles: | C=C([C@H]([C@@](C)(C=C)C1)CC2=C1OC=C2C)C |
|---|
KEYWORDS: buy Curzerene | Curzerene supplier | purchase | cost | manufacturer | order | distributor | buy 17910-09-7 | 17910-09-7 supplier