Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1176 | Purity: >98% |
 | |
| Chemical structure of CUDC-908 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1235449-52-1 |
|---|---|
| Purity | >98% |
| Formula | C23H25N9O3S |
| Mol Weight | 507.568 |
| CoA | CoA of CUDC-908 |
| Smiles: | CNC1=CC=C(C=N1)C1=NC(N2CCOCC2)=C2SC(CN(C)C3=NC=C(C=N3)C(=O)NO)=CC2=N1 |
|---|
KEYWORDS: buy CUDC-908 | CUDC-908 supplier | purchase | cost | manufacturer | order | distributor | buy 1235449-52-1 | 1235449-52-1 supplier