Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9088A | Purity: >98% |
 | |
| Chemical structure of CTOP TFA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2828432-43-3 |
|---|---|
| Purity | >98% |
| Formula | C52H68F3N11O13S2 |
| Mol Weight | 1176.287 |
| CoA | CoA of CTOP TFA |
| Smiles: | C(C(O)=O)(F)(F)F.C(C=1C=2C(NC1)=CC=CC2)[C@H]3NC(=O)[C@H](CC4=CC=C(O)C=C4)NC(=O)[C@@H](NC([C@@H](CC5=CC=CC=C5)N)=O)CSSC(C)(C)[C@@H](C(N[C@@H]([C@@H](C)O)C(N)=O)=O)NC(=O)[C@]([C@@H](C)O)(NC(=O)[C@H](CCCN)NC3=O)[H] |
|---|
KEYWORDS: buy CTOP TFA | CTOP TFA supplier | purchase | cost | manufacturer | order | distributor | buy 2828432-43-3 | 2828432-43-3 supplier