Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3700 | Purity: >98% |
 | |
| Chemical structure of CRTh2 antagonist 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1379445-54-1 |
|---|---|
| Purity | >98% |
| Formula | C23H25N3O5S |
| Mol Weight | 455.527 |
| CoA | CoA of CRTh2 antagonist 1 |
| Smiles: | O=C(O)CC1=C(C)N(CC2=CC=CC=C2S(=O)(N3CCOCC3)=O)N=C1C4=CC=CC=C4 |
|---|
KEYWORDS: buy CRTh2 antagonist 1 | CRTh2 antagonist 1 supplier | purchase | cost | manufacturer | order | distributor | buy 1379445-54-1 | 1379445-54-1 supplier