Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A631 | Purity: >98% |
 | |
| Chemical structure of CPI-268456 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1380087-86-4 |
|---|---|
| Purity | >98% |
| Formula | C20H15Cl2N3O2 |
| Mol Weight | 400.258 |
| CoA | CoA of CPI-268456 |
| Smiles: | CC1=NOC2=C1C1=C(C=C(Cl)C=C1)C(=N[C@@H]2CC(N)=O)C1=CC=C(Cl)C=C1 |
|---|
KEYWORDS: buy CPI-268456 | CPI-268456 supplier | purchase | cost | manufacturer | order | distributor | buy 1380087-86-4 | 1380087-86-4 supplier