Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A284 | Purity: >98% |
 | |
| Chemical structure of CP673451 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 343787-29-1 |
|---|---|
| Purity | >98% |
| Formula | C24H27N5O2 |
| Mol Weight | 417.5035 |
| CoA | CoA of CP673451 |
| Smiles: | COCCOC1=CC=C2N(C=NC2=C1)C1=NC2=C(C=CC=C2C=C1)N1CCC(N)CC1 |
|---|
KEYWORDS: buy CP673451 | CP673451 supplier | purchase | cost | manufacturer | order | distributor | buy 343787-29-1 | 343787-29-1 supplier