Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14974 | Purity: >98% |
 | |
| Chemical structure of Compound STL565749 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 879771-67-2 |
|---|---|
| Purity | >98% |
| Formula | C19H17N3O |
| Mol Weight | 303.3578 |
| CoA | CoA of Compound STL565749 |
| Smiles: | C1CNC(C2=C1C3=CC=CC=C3N2)C4C5=CC=CC=C5NC4=O |
|---|
KEYWORDS: buy Compound STL565749 | Compound STL565749 supplier | purchase | cost | manufacturer | order | distributor | buy 879771-67-2 | 879771-67-2 supplier