Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A739 | Purity: >98% |
 | |
| Chemical structure of Coluracetam |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MKC-231 |
|---|---|
| Synonyms 2 | BCI-540 |
| CAS No. | 135463-81-9 |
| Purity | >98% |
| Formula | C19H23N3O3 |
| Mol Weight | 341.4042 |
| CoA | CoA of Coluracetam |
| Smiles: | CC1=C(C)C2=C(NC(=O)CN3CCCC3=O)C3=C(CCCC3)N=C2O1 |
|---|
KEYWORDS: buy Coluracetam | Coluracetam supplier | purchase | cost | manufacturer | order | distributor | buy 135463-81-9 | 135463-81-9 supplier