Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12777 | Purity: >98% |
 | |
| Chemical structure of clausine M |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 250259-33-7 |
|---|---|
| Purity | >98% |
| Formula | C14H11NO3 |
| Mol Weight | 241.242 |
| CoA | CoA of clausine M |
| Smiles: | O=C(OC)C1=CC=C2NC=3C=C(O)C=CC3C2=C1 |
|---|
KEYWORDS: buy clausine M | clausine M supplier | purchase | cost | manufacturer | order | distributor | buy 250259-33-7 | 250259-33-7 supplier