Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A714 | Purity: >98% |
 | |
| Chemical structure of CK-1827452 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Omecamtiv mecarbil |
|---|---|
| CAS No. | 873697-71-3 |
| Purity | >98% |
| Formula | C20H24FN5O3 |
| Mol Weight | 401.4347 |
| CoA | CoA of CK-1827452 |
| Smiles: | COC(=O)N1CCN(CC2=CC=CC(NC(=O)NC3=CC=C(C)N=C3)=C2F)CC1 |
|---|
KEYWORDS: buy CK-1827452 | CK-1827452 supplier | purchase | cost | manufacturer | order | distributor | buy 873697-71-3 | 873697-71-3 supplier