Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2680 | Purity: >98% |
 | |
| Chemical structure of Cindunistat |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PF-00572986 |
|---|---|
| Synonyms 2 | PHA-84250 |
| CAS No. | 364067-22-1 |
| Purity | >98% |
| Formula | C8H17N3O2S |
| Mol Weight | 219.304 |
| CoA | CoA of Cindunistat |
| Smiles: | C\C(N)=N\CCSC[C@](C)(N)C(O)=O |
|---|
KEYWORDS: buy Cindunistat | Cindunistat supplier | purchase | cost | manufacturer | order | distributor | buy 364067-22-1 | 364067-22-1 supplier