Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14972 | Purity: >98% |
 | |
| Chemical structure of CI13015 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2706-28-7 |
|---|---|
| Purity | >98% |
| Formula | C12H9N3Na2O6S2 |
| Mol Weight | 401.326 |
| CoA | CoA of CI13015 |
| Smiles: | C1=CC(=CC=C1N=NC2=CC(=C(C=C2)N)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
|---|
KEYWORDS: buy CI13015 | CI13015 supplier | purchase | cost | manufacturer | order | distributor | buy 2706-28-7 | 2706-28-7 supplier