Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A224 | Purity: >98% |
 | |
| Chemical structure of CI-994 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Tacedinaline |
|---|---|
| CAS No. | 112522-64-2 |
| Purity | >98% |
| Formula | C15H15N3O2 |
| Mol Weight | 269.2985 |
| CoA | CoA of CI-994 |
| Smiles: | CC(=O)NC1=CC=C(C=C1)C(=O)NC1=CC=CC=C1N |
|---|
KEYWORDS: buy CI-994 | CI-994 supplier | purchase | cost | manufacturer | order | distributor | buy 112522-64-2 | 112522-64-2 supplier