Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10455 | Purity: >98% |
 | |
| Chemical structure of Chitin synthase inhibitor 4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2755847-31-3 |
|---|---|
| Purity | >98% |
| Formula | C20H15FN4O |
| Mol Weight | 346.3577 |
| CoA | CoA of Chitin synthase inhibitor 4 |
| Smiles: | N#CC1=CC=CC=C1OC2=NC=NC(N3CCCC4=C3C=CC=C4)=C2F |
|---|
KEYWORDS: buy Chitin synthase inhibitor 4 | Chitin synthase inhibitor 4 supplier | purchase | cost | manufacturer | order | distributor | buy 2755847-31-3 | 2755847-31-3 supplier