Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1079 | Purity: >98% |
 | |
| Chemical structure of CHIR-98014 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 252935-94-7 |
|---|---|
| Purity | >98% |
| Formula | C20H17Cl2N9O2 |
| Mol Weight | 486.314 |
| Color | white to brown |
| State | powder |
| Solubility | DMSO: 0.5 mg/mL, clear (warmed) |
| Shelf Life | >2 years if stored properly |
| Storage | −20℃ |
| CoA | CoA of CHIR-98014 |
| Smiles: | NC1=NC(NCCNC2=NC=C(N3C=CN=C3)C(=N2)C2=CC=C(Cl)C=C2Cl)=CC=C1[N+]([O-])=O |
|---|
KEYWORDS: buy CHIR-98014 | CHIR-98014 supplier | purchase | cost | manufacturer | order | distributor | buy 252935-94-7 | 252935-94-7 supplier