Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2209 | Purity: >98% |
 | |
| Chemical structure of Chidamide |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | CS055 |
|---|---|
| Synonyms 2 | HBI-8000 |
| CAS No. | 743420-02-2 |
| Purity | >98% |
| Formula | C22H19FN4O2 |
| Mol Weight | 390.4103 |
| CoA | CoA of Chidamide |
| Smiles: | NC1=CC=C(F)C=C1NC(=O)C1=CC=C(CNC(=O)\C=C\C2=CC=CN=C2)C=C1 |
|---|
KEYWORDS: buy Chidamide | Chidamide supplier | purchase | cost | manufacturer | order | distributor | buy 743420-02-2 | 743420-02-2 supplier