Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1963 | Purity: >98% |
 | |
| Chemical structure of CHF5074 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 749269-83-8 |
|---|---|
| Purity | >98% |
| Formula | C16H11Cl2FO2 |
| Mol Weight | 325.162 |
| CoA | CoA of CHF5074 |
| Smiles: | OC(=O)C1(CC1)C1=CC(F)=C(C=C1)C1=CC(Cl)=C(Cl)C=C1 |
|---|
KEYWORDS: buy CHF5074 | CHF5074 supplier | purchase | cost | manufacturer | order | distributor | buy 749269-83-8 | 749269-83-8 supplier