Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4920 | Purity: >98% |
 | |
| Chemical structure of Chaetocin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 28097-03-2 |
|---|---|
| Purity | >98% |
| Formula | C30H28N6O6S4 |
| Mol Weight | 696.84 |
| CoA | CoA of Chaetocin |
| Smiles: | CN1C(=O)C23CC4(C(N2C(=O)C1(SS3)CO)NC5=CC=CC=C54)C67CC89C(=O)N(C(C(=O)N8C6NC1=CC=CC=C71)(SS9)CO)C |
|---|
KEYWORDS: buy Chaetocin | Chaetocin supplier | purchase | cost | manufacturer | order | distributor | buy 28097-03-2 | 28097-03-2 supplier