Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1122 | Purity: >98% |
 | |
| Chemical structure of CH5183284 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Debio-1347 |
|---|---|
| CAS No. | 1265229-25-1 |
| Purity | >98% |
| Formula | C20H16N6O |
| Mol Weight | 356.3806 |
| CoA | CoA of CH5183284 |
| Smiles: | CC1=NC2=CC=C(C=C2N1)N1N=CC(C(=O)C2=CC3=C(N2)C=CC=C3)=C1N |
|---|
KEYWORDS: buy CH5183284 | CH5183284 supplier | purchase | cost | manufacturer | order | distributor | buy 1265229-25-1 | 1265229-25-1 supplier