Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A614 | Purity: >98% |
 | |
| Chemical structure of CGI-1746 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 910232-84-7 |
|---|---|
| Purity | >98% |
| Formula | C34H37N5O4 |
| Mol Weight | 579.6887 |
| CoA | CoA of CGI-1746 |
| Smiles: | CN1C=C(N=C(NC2=CC=C(C=C2)C(=O)N2CCOCC2)C1=O)C1=C(C)C(NC(=O)C2=CC=C(C=C2)C(C)(C)C)=CC=C1 |
|---|
KEYWORDS: buy CGI-1746 | CGI-1746 supplier | purchase | cost | manufacturer | order | distributor | buy 910232-84-7 | 910232-84-7 supplier