Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3856 | Purity: >98% |
 | |
| Chemical structure of Cetrorelix acetate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 130143-01-0 |
|---|---|
| Purity | >98% |
| Formula | C74H100ClN17O18 |
| Mol Weight | 1551.142 |
| CoA | CoA of Cetrorelix acetate |
| Smiles: | C[C@H](C(=O)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CCCNC(=O)N)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC3=CN=CC=C3)NC(=O)[C@@H](CC4=CC=C(C=C4)Cl)NC(=O)[C@@H](CC5=CC6=CC=CC=C6C=C5)NC(=O)C.CC(=O)O.CC(=O)O |
|---|
KEYWORDS: buy Cetrorelix acetate | Cetrorelix acetate supplier | purchase | cost | manufacturer | order | distributor | buy 130143-01-0 | 130143-01-0 supplier