Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2610 | Purity: >98% |
 | |
| Chemical structure of CERC-501 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | LY-2456302 |
|---|---|
| CAS No. | 1174130-61-0 |
| Purity | >98% |
| Formula | C26H27FN2O2 |
| Mol Weight | 418.5032 |
| CoA | CoA of CERC-501 |
| Smiles: | CC1=CC(=CC(C)=C1)[C@@H]1CCCN1CC1=CC=C(OC2=CC=C(C=C2F)C(N)=O)C=C1 |
|---|
KEYWORDS: buy CERC-501 | CERC-501 supplier | purchase | cost | manufacturer | order | distributor | buy 1174130-61-0 | 1174130-61-0 supplier