Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2039 | Purity: >98% |
 | |
| Chemical structure of Cediranib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | AZD2171 |
|---|---|
| CAS No. | 288383-20-0 |
| Purity | >98% |
| Formula | C25H27FN4O3 |
| Mol Weight | 450.5053 |
| CoA | CoA of Cediranib |
| Smiles: | COC1=CC2=C(OC3=C(F)C4=C(NC(C)=C4)C=C3)N=CN=C2C=C1OCCCN1CCCC1 |
|---|
KEYWORDS: buy Cediranib | Cediranib supplier | purchase | cost | manufacturer | order | distributor | buy 288383-20-0 | 288383-20-0 supplier