Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2277 | Purity: >98% |
 | |
| Chemical structure of CCT244747 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1404095-34-6 |
|---|---|
| Purity | >98% |
| Formula | C20H24N8O2 |
| Mol Weight | 408.457 |
| CoA | CoA of CCT244747 |
| Smiles: | COC1=CC(NC2=CN=C(C#N)C(O[C@H](C)CN(C)C)=N2)=NC=C1C1=CN(C)N=C1 |
|---|
KEYWORDS: buy CCT244747 | CCT244747 supplier | purchase | cost | manufacturer | order | distributor | buy 1404095-34-6 | 1404095-34-6 supplier