Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2038 | Purity: >98% |
 | |
| Chemical structure of CCT137690 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1095382-05-0 |
|---|---|
| Purity | >98% |
| Formula | C26H31BrN8O |
| Mol Weight | 551.481 |
| CoA | CoA of CCT137690 |
| Smiles: | CN1CCN(CC1)C1=CC=C(C=C1)C1=NC2=C(N3CCN(CC4=NOC(C)=C4)CC3)C(Br)=CN=C2N1 |
|---|
KEYWORDS: buy CCT137690 | CCT137690 supplier | purchase | cost | manufacturer | order | distributor | buy 1095382-05-0 | 1095382-05-0 supplier