Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3707 | Purity: >98% |
 | |
| Chemical structure of CCT 039841 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 32502-21-9 |
|---|---|
| Purity | >98% |
| Formula | C11H9N5O2S |
| Mol Weight | 275.286 |
| CoA | CoA of CCT 039841 |
| Smiles: | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=CS3)C |
|---|
KEYWORDS: buy CCT 039841 | CCT 039841 supplier | purchase | cost | manufacturer | order | distributor | buy 32502-21-9 | 32502-21-9 supplier