Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1071 | Purity: >98% |
 | |
| Chemical structure of CCG215022 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1813527-81-9 |
|---|---|
| Purity | >98% |
| Formula | C26H22FN7O3 |
| Mol Weight | 499.4964 |
| CoA | CoA of CCG215022 |
| Smiles: | CC1=C(C(NC(=O)N1)C1=CC=C(F)C(=C1)C(=O)NCC1=CC=CC=N1)C(=O)NC1=CC=C2NN=CC2=C1 |
|---|
KEYWORDS: buy CCG215022 | CCG215022 supplier | purchase | cost | manufacturer | order | distributor | buy 1813527-81-9 | 1813527-81-9 supplier