Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14886 | Purity: >98% |
 | |
| Chemical structure of CCG-977 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 284487-50-9 |
|---|---|
| Purity | >98% |
| Formula | C21H13ClF6N2O3S |
| Mol Weight | 522.848 |
| CoA | CoA of CCG-977 |
| Smiles: | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)Cl |
|---|
KEYWORDS: buy CCG-977 | CCG-977 supplier | purchase | cost | manufacturer | order | distributor | buy 284487-50-9 | 284487-50-9 supplier