Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A106 | Purity: >98% |
 | |
| Chemical structure of CB7598 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 154229-19-3 |
|---|---|
| Purity | >98% |
| Formula | C24H31NO |
| Mol Weight | 349.509 |
| CoA | CoA of CB7598 |
| Smiles: | [H][C@@]12CC=C(C3=CC=CN=C3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
|---|
KEYWORDS: buy CB7598 | CB7598 supplier | purchase | cost | manufacturer | order | distributor | buy 154229-19-3 | 154229-19-3 supplier