Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1257 | Purity: >99% |
 | |
| Chemical structure of Carteolol hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 51781-21-6 |
|---|---|
| Purity | >99% |
| Formula | C16H25ClN2O3 |
| Mol Weight | 328.834 |
| CoA | CoA of Carteolol hydrochloride |
| Smiles: | Cl[H].CC(C)(C)NCC(O)COC1=CC=CC2=C1CCC(=O)N2 |
|---|
KEYWORDS: buy Carteolol hydrochloride | Carteolol hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 51781-21-6 | 51781-21-6 supplier