Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15951 | Purity: >98% |
 | |
| Chemical structure of Carboxamide |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3032493-76-5 |
|---|---|
| Purity | >98% |
| Formula | C49H51ClN10O4S |
| Mol Weight | 911.512 |
| CoA | CoA of Carboxamide |
| Smiles: | O(C1CC2(C1)CCN(CC2)C=3N=CC(C(N[C@@H]4C(C)(C)[C@@H](OC5=CC(Cl)=C(C#N)C=C5)C4(C)C)=O)=CN3)C6=CC=C(C=C6)C=7C8=C(N9C([C@H](CC%10=NC=CO%10)N7)=NN=C9C)SC(C)=C8C |
|---|
KEYWORDS: buy Carboxamide | Carboxamide supplier | purchase | cost | manufacturer | order | distributor | buy 3032493-76-5 | 3032493-76-5 supplier