Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2367 | Purity: >98% |
 | |
| Chemical structure of Capromorelin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 193273-66-4 |
|---|---|
| Purity | >98% |
| Formula | C28H35N5O4 |
| Mol Weight | 505.6086 |
| CoA | CoA of Capromorelin |
| Smiles: | CN1N=C2CCN(C[C@@]2(CC2=CC=CC=C2)C1=O)C(=O)[C@@H](COCC1=CC=CC=C1)NC(=O)C(C)(C)N |
|---|
KEYWORDS: buy Capromorelin | Capromorelin supplier | purchase | cost | manufacturer | order | distributor | buy 193273-66-4 | 193273-66-4 supplier