Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A446 | Purity: >99% |
 | |
| Chemical structure of Capmatinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | INCB28060 |
|---|---|
| CAS No. | 1029712-80-8 |
| Purity | >99% |
| Formula | C23H17FN6O |
| Mol Weight | 412.4191 |
| CoA | CoA of Capmatinib |
| Smiles: | CNC(=O)C1=CC=C(C=C1F)C1=NN2C(CC3=CC=C4N=CC=CC4=C3)=CN=C2N=C1 |
|---|
KEYWORDS: buy Capmatinib | Capmatinib supplier | purchase | cost | manufacturer | order | distributor | buy 1029712-80-8 | 1029712-80-8 supplier