Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A752 | Purity: >98% |
 | |
| Chemical structure of Cambendazol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Cambendazole |
|---|---|
| Synonyms 2 | Novazole |
| CAS No. | 26097-80-3 |
| Purity | >98% |
| Formula | C14H14N4O2S |
| Mol Weight | 302.352 |
| CoA | CoA of Cambendazol |
| Smiles: | CC(C)OC(=O)NC1=CC=C2N=C(NC2=C1)C1=CSC=N1 |
|---|
KEYWORDS: buy Cambendazol | Cambendazol supplier | purchase | cost | manufacturer | order | distributor | buy 26097-80-3 | 26097-80-3 supplier