Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3636 | Purity: >98% |
 | |
| Chemical structure of CA-5f |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1370032-19-1 |
|---|---|
| Purity | >98% |
| Formula | C24H24N2O3 |
| Mol Weight | 388.459 |
| CoA | CoA of CA-5f |
| Smiles: | O=C(/C(CN(C)C/1)=C/C2=CNC3=C2C=CC=C3)C1=C\C4=CC=C(OC)C(OC)=C4 |
|---|
KEYWORDS: buy CA-5f | CA-5f supplier | purchase | cost | manufacturer | order | distributor | buy 1370032-19-1 | 1370032-19-1 supplier