Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12536 | Purity: >98% |
 | |
| Chemical structure of C90122 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 77718-46-8 |
|---|---|
| Purity | >98% |
| Formula | C7H6ClNO4S |
| Mol Weight | 235.645 |
| CoA | CoA of C90122 |
| Smiles: | O=C(N)C1=CC(=CC=C1O)S(=O)(=O)Cl |
|---|
KEYWORDS: buy C90122 | C90122 supplier | purchase | cost | manufacturer | order | distributor | buy 77718-46-8 | 77718-46-8 supplier