Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16613Q | Purity: >98% |
 | |
| Chemical structure of C36H40N4O5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2553413-49-1 |
|---|---|
| Purity | >98% |
| Formula | C36H40N4O5 |
| Mol Weight | 608.7266 |
| CoA | CoA of C36H40N4O5 |
| Smiles: | C(CCCCC(N[C@H](C(N[C@H](C(NC1=CC=C(CO)C=C1)=O)C)=O)[C@@H](C)C)=O)(=O)N2C=3C(C#CC=4C(C2)=CC=CC4)=CC=CC3 |
|---|
KEYWORDS: buy C36H40N4O5 | C36H40N4O5 supplier | purchase | cost | manufacturer | order | distributor | buy 2553413-49-1 | 2553413-49-1 supplier