Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A310 | Purity: >98% |
 | |
| Chemical structure of C-7280948 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 587850-67-7 |
|---|---|
| Purity | >98% |
| Formula | C14H16N2O2S |
| Mol Weight | 276.354 |
| CoA | CoA of C-7280948 |
| Smiles: | NC1=CC=C(C=C1)S(=O)(=O)NCCC1=CC=CC=C1 |
|---|
KEYWORDS: buy C-7280948 | C-7280948 supplier | purchase | cost | manufacturer | order | distributor | buy 587850-67-7 | 587850-67-7 supplier