Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14909 | Purity: >98% |
 | |
| Chemical structure of BzATP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 81790-82-1 |
|---|---|
| Purity | >98% |
| Formula | C24H24N5O15P3 |
| Mol Weight | 715.3931 |
| CoA | CoA of BzATP |
| Smiles: | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)O[C@@H]3[C@H](O[C@H]([C@@H]3O)N4C=NC5=C(N=CN=C54)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
|---|
KEYWORDS: buy BzATP | BzATP supplier | purchase | cost | manufacturer | order | distributor | buy 81790-82-1 | 81790-82-1 supplier