Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8178 | Purity: >98% |
 | |
| Chemical structure of BTM-3566 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2228857-70-1 |
|---|---|
| Purity | >98% |
| Formula | C24H23F4N3O2S2 |
| Mol Weight | 525.582 |
| CoA | CoA of BTM-3566 |
| Smiles: | O=C(C1=C(C(C)=NN1C2=NC(C3=CCC(C(F)(F)F)CC3)=C(SC(C)C)S2)C4=CC(F)=CC=C4)O |
|---|
KEYWORDS: buy BTM-3566 | BTM-3566 supplier | purchase | cost | manufacturer | order | distributor | buy 2228857-70-1 | 2228857-70-1 supplier